C17H18NO4- — CID 6923756
(5S,7R)-3-(4-nitrophenyl)adamantane-1-carboxylate (PubChem CID 6923756) has the molecular formula C17H18NO4- and a molecular weight of 300.33 g/mol. Its IUPAC name is (5S,7R)-3-(4-nitrophenyl)adamantane-1-carboxylate.
| Compound Name | (5S,7R)-3-(4-nitrophenyl)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 6923756 |
| Molecular Formula | C17H18NO4- |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (5S,7R)-3-(4-nitrophenyl)adamantane-1-carboxylate |
| SMILES | O=C([O-])C12C[C@H]3C[C@@H](C1)CC(c1ccc([N+](=O)[O-])cc1)(C3)C2 |
| InChI | InChI=1S/C17H19NO4/c19-15(20)17-8-11-5-12(9-17)7-16(6-11,10-17)13-1-3-14(4-2-13)18(21)22/h1-4,11-12H,5-10H2,(H,19,20)/p-1/t11-,12+,16?,17? |
| InChIKey | JGYFFTQRRDPOIR-GKUGFIGPSA-M |
| XLogP | 2.18 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|