C18H21NO4 — CID 780067
methyl (5S,7R)-3-(4-nitrophenyl)adamantane-1-carboxylate (PubChem CID 780067) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl (5S,7R)-3-(4-nitrophenyl)adamantane-1-carboxylate.
| Compound Name | methyl (5S,7R)-3-(4-nitrophenyl)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 780067 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | methyl (5S,7R)-3-(4-nitrophenyl)adamantane-1-carboxylate |
| SMILES | COC(=O)C12C[C@H]3C[C@@H](C1)CC(c1ccc([N+](=O)[O-])cc1)(C3)C2 |
| InChI | InChI=1S/C18H21NO4/c1-23-16(20)18-9-12-6-13(10-18)8-17(7-12,11-18)14-2-4-15(5-3-14)19(21)22/h2-5,12-13H,6-11H2,1H3/t12-,13+,17?,18? |
| InChIKey | KSJKKZIFUIBWPY-NLKGSNSHSA-N |
| XLogP | 3.61 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|