C24H25NO4 — CID 98423421
benzyl (5S,7S)-3-(4-nitrophenyl)adamantane-1-carboxylate (PubChem CID 98423421) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is benzyl (5S,7S)-3-(4-nitrophenyl)adamantane-1-carboxylate.
| Compound Name | benzyl (5S,7S)-3-(4-nitrophenyl)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 98423421 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | benzyl (5S,7S)-3-(4-nitrophenyl)adamantane-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)C12C[C@H]3C[C@H](C1)CC(c1ccc([N+](=O)[O-])cc1)(C3)C2 |
| InChI | InChI=1S/C24H25NO4/c26-22(29-15-17-4-2-1-3-5-17)24-13-18-10-19(14-24)12-23(11-18,16-24)20-6-8-21(9-7-20)25(27)28/h1-9,18-19H,10-16H2/t18-,19-,23?,24?/m0/s1 |
| InChIKey | JMRRKJLYZYJXPN-AYJAPBJVSA-N |
| XLogP | 5.18 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|