C19H23NO3 — CID 98406265
(2-amino-2-oxoethyl) (5S,7S)-3-phenyladamantane-1-carboxylate (PubChem CID 98406265) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (5S,7S)-3-phenyladamantane-1-carboxylate.
| Compound Name | (2-amino-2-oxoethyl) (5S,7S)-3-phenyladamantane-1-carboxylate |
|---|---|
| PubChem CID | 98406265 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (2-amino-2-oxoethyl) (5S,7S)-3-phenyladamantane-1-carboxylate |
| SMILES | NC(=O)COC(=O)C12C[C@H]3C[C@H](C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C19H23NO3/c20-16(21)11-23-17(22)19-9-13-6-14(10-19)8-18(7-13,12-19)15-4-2-1-3-5-15/h1-5,13-14H,6-12H2,(H2,20,21)/t13-,14-,18?,19?/m0/s1 |
| InChIKey | UYCWGFBABHSOAJ-IHWOHKJGSA-N |
| XLogP | 2.55 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |