C18H23NO — CID 27835435
2-[(5R,7S)-3-phenyl-1-adamantyl]acetamide (PubChem CID 27835435) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-[(5R,7S)-3-phenyl-1-adamantyl]acetamide.
| Compound Name | 2-[(5R,7S)-3-phenyl-1-adamantyl]acetamide |
|---|---|
| PubChem CID | 27835435 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 2-[(5R,7S)-3-phenyl-1-adamantyl]acetamide |
| SMILES | NC(=O)CC12C[C@H]3C[C@@H](C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C18H23NO/c19-16(20)11-17-7-13-6-14(8-17)10-18(9-13,12-17)15-4-2-1-3-5-15/h1-5,13-14H,6-12H2,(H2,19,20)/t13-,14+,17?,18? |
| InChIKey | VGLSVSSKSIKWQA-MWABVPJASA-N |
| XLogP | 3.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |