C19H25NO — CID 98161313
2-(methylamino)-1-[(5S,7S)-3-phenyl-1-adamantyl]ethanone (PubChem CID 98161313) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is 2-(methylamino)-1-[(5S,7S)-3-phenyl-1-adamantyl]ethanone.
| Compound Name | 2-(methylamino)-1-[(5S,7S)-3-phenyl-1-adamantyl]ethanone |
|---|---|
| PubChem CID | 98161313 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 2-(methylamino)-1-[(5S,7S)-3-phenyl-1-adamantyl]ethanone |
| SMILES | CNCC(=O)C12C[C@H]3C[C@H](C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C19H25NO/c1-20-12-17(21)19-10-14-7-15(11-19)9-18(8-14,13-19)16-5-3-2-4-6-16/h2-6,14-15,20H,7-13H2,1H3/t14-,15-,18?,19?/m0/s1 |
| InChIKey | ZJZVRPGENAAQNC-GKVPXEHWSA-N |
| XLogP | 3.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |