C23H31NO — CID 52510430
(4-methylpiperidin-1-yl)-[(5S,7R)-3-phenyl-1-adamantyl]methanone (PubChem CID 52510430) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-[(5S,7R)-3-phenyl-1-adamantyl]methanone.
| Compound Name | (4-methylpiperidin-1-yl)-[(5S,7R)-3-phenyl-1-adamantyl]methanone |
|---|---|
| PubChem CID | 52510430 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | (4-methylpiperidin-1-yl)-[(5S,7R)-3-phenyl-1-adamantyl]methanone |
| SMILES | CC1CCN(C(=O)C23C[C@H]4C[C@@H](C2)CC(c2ccccc2)(C4)C3)CC1 |
| InChI | InChI=1S/C23H31NO/c1-17-7-9-24(10-8-17)21(25)23-14-18-11-19(15-23)13-22(12-18,16-23)20-5-3-2-4-6-20/h2-6,17-19H,7-16H2,1H3/t18-,19+,22?,23? |
| InChIKey | FEWQATWZNHLVOP-MGAZVUHYSA-N |
| XLogP | 4.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |