C22H30N2O — CID 130269344
1,4-diazepan-1-yl-(3-phenyl-1-adamantyl)methanone (PubChem CID 130269344) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-(3-phenyl-1-adamantyl)methanone.
| Compound Name | 1,4-diazepan-1-yl-(3-phenyl-1-adamantyl)methanone |
|---|---|
| PubChem CID | 130269344 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 1,4-diazepan-1-yl-(3-phenyl-1-adamantyl)methanone |
| SMILES | O=C(N1CCCNCC1)C12CC3CC(C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C22H30N2O/c25-20(24-9-4-7-23-8-10-24)22-14-17-11-18(15-22)13-21(12-17,16-22)19-5-2-1-3-6-19/h1-3,5-6,17-18,23H,4,7-16H2 |
| InChIKey | DCGRUAMGDKPWQR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |