C22H27NO3 — CID 130247690
3-phenyl-5-(pyrrolidine-1-carbonyl)adamantane-1-carboxylic acid (PubChem CID 130247690) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 3-phenyl-5-(pyrrolidine-1-carbonyl)adamantane-1-carboxylic acid.
| Compound Name | 3-phenyl-5-(pyrrolidine-1-carbonyl)adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 130247690 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 3-phenyl-5-(pyrrolidine-1-carbonyl)adamantane-1-carboxylic acid |
| SMILES | O=C(O)C12CC3CC(C(=O)N4CCCC4)(C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C22H27NO3/c24-18(23-8-4-5-9-23)21-11-16-10-20(13-21,17-6-2-1-3-7-17)14-22(12-16,15-21)19(25)26/h1-3,6-7,16H,4-5,8-15H2,(H,25,26) |
| InChIKey | QLYCNQPSOINYCS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |