C29H40N2O2 — CID 98537815
azepan-1-yl-[1-[(5S,7S)-3-phenyladamantane-1-carbonyl]piperidin-4-yl]methanone (PubChem CID 98537815) has the molecular formula C29H40N2O2 and a molecular weight of 448.65 g/mol. Its IUPAC name is azepan-1-yl-[1-[(5S,7S)-3-phenyladamantane-1-carbonyl]piperidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[1-[(5S,7S)-3-phenyladamantane-1-carbonyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 98537815 |
| Molecular Formula | C29H40N2O2 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.31 |
| IUPAC Name | azepan-1-yl-[1-[(5S,7S)-3-phenyladamantane-1-carbonyl]piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(C(=O)C23C[C@H]4C[C@H](C2)CC(c2ccccc2)(C4)C3)CC1)N1CCCCCC1 |
| InChI | InChI=1S/C29H40N2O2/c32-26(30-12-6-1-2-7-13-30)24-10-14-31(15-11-24)27(33)29-19-22-16-23(20-29)18-28(17-22,21-29)25-8-4-3-5-9-25/h3-5,8-9,22-24H,1-2,6-7,10-21H2/t22-,23-,28?,29?/m0/s1 |
| InChIKey | ZONXDOYRNCFWQZ-AEACUUAWSA-N |
| XLogP | 5.17 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |