C29H34N2O2 — CID 98171398
[4-[(5S,7S)-3-(4-methylphenyl)adamantane-1-carbonyl]piperazin-1-yl]-phenylmethanone (PubChem CID 98171398) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is [4-[(5S,7S)-3-(4-methylphenyl)adamantane-1-carbonyl]piperazin-1-yl]-phenylmethanone.
| Compound Name | [4-[(5S,7S)-3-(4-methylphenyl)adamantane-1-carbonyl]piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 98171398 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | [4-[(5S,7S)-3-(4-methylphenyl)adamantane-1-carbonyl]piperazin-1-yl]-phenylmethanone |
| SMILES | Cc1ccc(C23C[C@@H]4C[C@H](CC(C(=O)N5CCN(C(=O)c6ccccc6)CC5)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C29H34N2O2/c1-21-7-9-25(10-8-21)28-16-22-15-23(17-28)19-29(18-22,20-28)27(33)31-13-11-30(12-14-31)26(32)24-5-3-2-4-6-24/h2-10,22-23H,11-20H2,1H3/t22-,23-,28?,29?/m0/s1 |
| InChIKey | UHHJYIWTSWJHKP-AEACUUAWSA-N |
| XLogP | 4.82 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |