C19H24O2 — CID 98116671
methyl (5R,7R)-3-(4-methylphenyl)adamantane-1-carboxylate (PubChem CID 98116671) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is methyl (5R,7R)-3-(4-methylphenyl)adamantane-1-carboxylate.
| Compound Name | methyl (5R,7R)-3-(4-methylphenyl)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 98116671 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | methyl (5R,7R)-3-(4-methylphenyl)adamantane-1-carboxylate |
| SMILES | COC(=O)C12C[C@@H]3C[C@@H](C1)CC(c1ccc(C)cc1)(C3)C2 |
| InChI | InChI=1S/C19H24O2/c1-13-3-5-16(6-4-13)18-8-14-7-15(9-18)11-19(10-14,12-18)17(20)21-2/h3-6,14-15H,7-12H2,1-2H3/t14-,15-,18?,19?/m1/s1 |
| InChIKey | HTEDSIKOCHFGBH-QAQJPARQSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |