C26H29NO3 — CID 98286596
[2-(4-methylanilino)-2-oxoethyl] (5R,7R)-3-phenyladamantane-1-carboxylate (PubChem CID 98286596) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] (5R,7R)-3-phenyladamantane-1-carboxylate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] (5R,7R)-3-phenyladamantane-1-carboxylate |
|---|---|
| PubChem CID | 98286596 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] (5R,7R)-3-phenyladamantane-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)C23C[C@@H]4C[C@@H](C2)CC(c2ccccc2)(C4)C3)cc1 |
| InChI | InChI=1S/C26H29NO3/c1-18-7-9-22(10-8-18)27-23(28)16-30-24(29)26-14-19-11-20(15-26)13-25(12-19,17-26)21-5-3-2-4-6-21/h2-10,19-20H,11-17H2,1H3,(H,27,28)/t19-,20-,25?,26?/m1/s1 |
| InChIKey | REEPGYVYQRKLKO-WSQGFLFRSA-N |
| XLogP | 5.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |