C20H24BrNO3 — CID 7833182
[2-(3-methylanilino)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate (PubChem CID 7833182) has the molecular formula C20H24BrNO3 and a molecular weight of 406.32 g/mol. Its IUPAC name is [2-(3-methylanilino)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate.
| Compound Name | [2-(3-methylanilino)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 7833182 |
| Molecular Formula | C20H24BrNO3 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | [2-(3-methylanilino)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate |
| SMILES | Cc1cccc(NC(=O)COC(=O)C23C[C@@H]4C[C@@H](CC(Br)(C4)C2)C3)c1 |
| InChI | InChI=1S/C20H24BrNO3/c1-13-3-2-4-16(5-13)22-17(23)11-25-18(24)19-7-14-6-15(8-19)10-20(21,9-14)12-19/h2-5,14-15H,6-12H2,1H3,(H,22,23)/t14-,15+,19?,20? |
| InChIKey | VIZWAYRKOWBXKC-JNKARSBBSA-N |
| XLogP | 4.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|