C20H22BrF2NO4 — CID 98289795
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate (PubChem CID 98289795) has the molecular formula C20H22BrF2NO4 and a molecular weight of 458.30 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98289795 |
| Molecular Formula | C20H22BrF2NO4 |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H22BrF2NO4/c21-20-8-12-5-13(9-20)7-19(6-12,11-20)17(26)27-10-16(25)24-14-1-3-15(4-2-14)28-18(22)23/h1-4,12-13,18H,5-11H2,(H,24,25)/t12-,13-,19?,20?/m1/s1 |
| InChIKey | YOSZXYVTHVRQSZ-CJKMCJCZSA-N |
| XLogP | 4.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|