C14H13Cl2F2NO4 — CID 3884342
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 3884342) has the molecular formula C14H13Cl2F2NO4 and a molecular weight of 368.16 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 3884342 |
| Molecular Formula | C14H13Cl2F2NO4 |
| Molecular Weight | 368.16 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | CC1(C(=O)OCC(=O)Nc2ccc(OC(F)F)cc2)CC1(Cl)Cl |
| InChI | InChI=1S/C14H13Cl2F2NO4/c1-13(7-14(13,15)16)11(21)22-6-10(20)19-8-2-4-9(5-3-8)23-12(17)18/h2-5,12H,6-7H2,1H3,(H,19,20) |
| InChIKey | DJRKLHKMQJMBLU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.16 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|