C13H12Cl2INO3 — CID 2391720
[2-(4-iodoanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 2391720) has the molecular formula C13H12Cl2INO3 and a molecular weight of 428.05 g/mol. Its IUPAC name is [2-(4-iodoanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-(4-iodoanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 2391720 |
| Molecular Formula | C13H12Cl2INO3 |
| Molecular Weight | 428.05 g/mol |
| Exact Mass | 426.92 |
| IUPAC Name | [2-(4-iodoanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | C[C@]1(C(=O)OCC(=O)Nc2ccc(I)cc2)CC1(Cl)Cl |
| InChI | InChI=1S/C13H12Cl2INO3/c1-12(7-13(12,14)15)11(19)20-6-10(18)17-9-4-2-8(16)3-5-9/h2-5H,6-7H2,1H3,(H,17,18)/t12-/m1/s1 |
| InChIKey | LWTNWIIJHIUJEY-GFCCVEGCSA-N |
| XLogP | 3.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.05 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|