C15H15Cl2NO5 — CID 9454627
methyl 4-[[2-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]oxyacetyl]amino]benzoate (PubChem CID 9454627) has the molecular formula C15H15Cl2NO5 and a molecular weight of 360.19 g/mol. Its IUPAC name is methyl 4-[[2-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]oxyacetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 9454627 |
| Molecular Formula | C15H15Cl2NO5 |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | methyl 4-[[2-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)COC(=O)[C@@]2(C)CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C15H15Cl2NO5/c1-14(8-15(14,16)17)13(21)23-7-11(19)18-10-5-3-9(4-6-10)12(20)22-2/h3-6H,7-8H2,1-2H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | AJZXOBJUKXAZPT-CQSZACIVSA-N |
| XLogP | 2.54 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|