C16H17Cl2NO5 — CID 7863945
methyl 3-[[2-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]oxyacetyl]amino]-4-methylbenzoate (PubChem CID 7863945) has the molecular formula C16H17Cl2NO5 and a molecular weight of 374.22 g/mol. Its IUPAC name is methyl 3-[[2-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]oxyacetyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[2-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]oxyacetyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 7863945 |
| Molecular Formula | C16H17Cl2NO5 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | methyl 3-[[2-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]oxyacetyl]amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)COC(=O)[C@@]2(C)CC2(Cl)Cl)c1 |
| InChI | InChI=1S/C16H17Cl2NO5/c1-9-4-5-10(13(21)23-3)6-11(9)19-12(20)7-24-14(22)15(2)8-16(15,17)18/h4-6H,7-8H2,1-3H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | KAVOLAXUJUDXMP-OAHLLOKOSA-N |
| XLogP | 2.85 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|