C14H13Cl4NO3 — CID 2619150
[2-(2,6-dichloro-3-methylanilino)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 2619150) has the molecular formula C14H13Cl4NO3 and a molecular weight of 385.07 g/mol. Its IUPAC name is [2-(2,6-dichloro-3-methylanilino)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-(2,6-dichloro-3-methylanilino)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 2619150 |
| Molecular Formula | C14H13Cl4NO3 |
| Molecular Weight | 385.07 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | [2-(2,6-dichloro-3-methylanilino)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | Cc1ccc(Cl)c(NC(=O)COC(=O)[C@]2(C)CC2(Cl)Cl)c1Cl |
| InChI | InChI=1S/C14H13Cl4NO3/c1-7-3-4-8(15)11(10(7)16)19-9(20)5-22-12(21)13(2)6-14(13,17)18/h3-4H,5-6H2,1-2H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | NUUWWAIQCCLIMG-ZDUSSCGKSA-N |
| XLogP | 4.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.07 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|