C13H11Cl4NO3 — CID 2363515
[2-(2,5-dichloroanilino)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 2363515) has the molecular formula C13H11Cl4NO3 and a molecular weight of 371.05 g/mol. Its IUPAC name is [2-(2,5-dichloroanilino)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-(2,5-dichloroanilino)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 2363515 |
| Molecular Formula | C13H11Cl4NO3 |
| Molecular Weight | 371.05 g/mol |
| Exact Mass | 368.95 |
| IUPAC Name | [2-(2,5-dichloroanilino)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | C[C@@]1(C(=O)OCC(=O)Nc2cc(Cl)ccc2Cl)CC1(Cl)Cl |
| InChI | InChI=1S/C13H11Cl4NO3/c1-12(6-13(12,16)17)11(20)21-5-10(19)18-9-4-7(14)2-3-8(9)15/h2-4H,5-6H2,1H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | DLOQFNOHHNCNAQ-LBPRGKRZSA-N |
| XLogP | 4.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.05 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|