C15H15Cl2NO4 — CID 46790009
[2-(2-acetylanilino)-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 46790009) has the molecular formula C15H15Cl2NO4 and a molecular weight of 344.19 g/mol. Its IUPAC name is [2-(2-acetylanilino)-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-(2-acetylanilino)-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 46790009 |
| Molecular Formula | C15H15Cl2NO4 |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | [2-(2-acetylanilino)-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | CC(=O)c1ccccc1NC(=O)COC(=O)C1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C15H15Cl2NO4/c1-9(19)10-5-3-4-6-11(10)18-12(20)7-22-13(21)14(2)8-15(14,16)17/h3-6H,7-8H2,1-2H3,(H,18,20) |
| InChIKey | KYPAIRHULBWOLY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|