C18H22Cl2N2O4 — CID 9454637
[2-[2-(2-methylpropylcarbamoyl)anilino]-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 9454637) has the molecular formula C18H22Cl2N2O4 and a molecular weight of 401.29 g/mol. Its IUPAC name is [2-[2-(2-methylpropylcarbamoyl)anilino]-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-[2-(2-methylpropylcarbamoyl)anilino]-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 9454637 |
| Molecular Formula | C18H22Cl2N2O4 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | [2-[2-(2-methylpropylcarbamoyl)anilino]-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | CC(C)CNC(=O)c1ccccc1NC(=O)COC(=O)[C@]1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C18H22Cl2N2O4/c1-11(2)8-21-15(24)12-6-4-5-7-13(12)22-14(23)9-26-16(25)17(3)10-18(17,19)20/h4-7,11H,8-10H2,1-3H3,(H,21,24)(H,22,23)/t17-/m0/s1 |
| InChIKey | NAINCXBIMAYMCV-KRWDZBQOSA-N |
| XLogP | 3.14 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|