C15H20N2O4 — CID 102610803
methyl 4-methyl-3-[[2-(3-methylazetidin-3-yl)oxyacetyl]amino]benzoate (PubChem CID 102610803) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is methyl 4-methyl-3-[[2-(3-methylazetidin-3-yl)oxyacetyl]amino]benzoate.
| Compound Name | methyl 4-methyl-3-[[2-(3-methylazetidin-3-yl)oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 102610803 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | methyl 4-methyl-3-[[2-(3-methylazetidin-3-yl)oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)COC2(C)CNC2)c1 |
| InChI | InChI=1S/C15H20N2O4/c1-10-4-5-11(14(19)20-3)6-12(10)17-13(18)7-21-15(2)8-16-9-15/h4-6,16H,7-9H2,1-3H3,(H,17,18) |
| InChIKey | POBXLGHKLYBWQL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |