C15H16Cl2O3 — CID 2349048
[2-(3,4-dimethylphenyl)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 2349048) has the molecular formula C15H16Cl2O3 and a molecular weight of 315.20 g/mol. Its IUPAC name is [2-(3,4-dimethylphenyl)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 2349048 |
| Molecular Formula | C15H16Cl2O3 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)[C@]2(C)CC2(Cl)Cl)cc1C |
| InChI | InChI=1S/C15H16Cl2O3/c1-9-4-5-11(6-10(9)2)12(18)7-20-13(19)14(3)8-15(14,16)17/h4-6H,7-8H2,1-3H3/t14-/m0/s1 |
| InChIKey | OJRMWMYRKTZEMZ-AWEZNQCLSA-N |
| XLogP | 3.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|