C14H14Cl2O4 — CID 2379090
[2-(4-methoxyphenyl)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 2379090) has the molecular formula C14H14Cl2O4 and a molecular weight of 317.17 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 2379090 |
| Molecular Formula | C14H14Cl2O4 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | COc1ccc(C(=O)COC(=O)[C@@]2(C)CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H14Cl2O4/c1-13(8-14(13,15)16)12(18)20-7-11(17)9-3-5-10(19-2)6-4-9/h3-6H,7-8H2,1-2H3/t13-/m1/s1 |
| InChIKey | XDLFPYSIDQWFAK-CYBMUJFWSA-N |
| XLogP | 3.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|