C12H14O5 — CID 70980265
[2-(4-methoxyphenyl)-2-oxoethyl] 2-hydroxypropanoate (PubChem CID 70980265) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 2-hydroxypropanoate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-hydroxypropanoate |
|---|---|
| PubChem CID | 70980265 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-hydroxypropanoate |
| SMILES | COc1ccc(C(=O)COC(=O)C(C)O)cc1 |
| InChI | InChI=1S/C12H14O5/c1-8(13)12(15)17-7-11(14)9-3-5-10(16-2)6-4-9/h3-6,8,13H,7H2,1-2H3 |
| InChIKey | NPSFYMMNZWCANN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |