About 1-(4-methoxyphenyl)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-dimethyl-λ4-selanyl]ethanone
1-(4-methoxyphenyl)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-dimethyl-λ4-selanyl]ethanone (PubChem CID 21357126) has the molecular formula C20H24O4Se
and a molecular weight of 407.37 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-dimethyl-λ4-selanyl]ethanone.
Molecular Properties
| Compound Name | 1-(4-methoxyphenyl)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-dimethyl-λ4-selanyl]ethanone |
| PubChem CID | 21357126 |
| Molecular Formula | C20H24O4Se |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-dimethyl-λ4-selanyl]ethanone |
| SMILES | COc1ccc(C(=O)C[Se](C)(C)CC(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H24O4Se/c1-23-17-9-5-15(6-10-17)19(21)13-25(3,4)14-20(22)16-7-11-18(24-2)12-8-16/h5-12H,13-14H2,1-4H3 |
| InChIKey | VVJRSNGXZMXWOQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methoxyphenyl)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-dimethyl-λ4-selanyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxyphenyl)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-dimethyl-λ4-selanyl]ethanone?
The IUPAC name of 1-(4-methoxyphenyl)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-dimethyl-λ4-selanyl]ethanone (CID 21357126) is 1-(4-methoxyphenyl)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-dimethyl-λ4-selanyl]ethanone.
What is the SMILES notation for 1-(4-methoxyphenyl)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-dimethyl-λ4-selanyl]ethanone?
The canonical SMILES for 1-(4-methoxyphenyl)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-dimethyl-λ4-selanyl]ethanone is COc1ccc(C(=O)C[Se](C)(C)CC(=O)c2ccc(OC)cc2)cc1.
What is the InChIKey of 1-(4-methoxyphenyl)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-dimethyl-λ4-selanyl]ethanone?
The InChIKey is VVJRSNGXZMXWOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O4Se/c1-23-17-9-5-15(6-10-17)19(21)13-25(3,4)14-20(22)16-7-11-18(24-2)12-8-16/h5-12H,13-14H2,1-4H3.
What are the key properties of 1-(4-methoxyphenyl)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-dimethyl-λ4-selanyl]ethanone?
1-(4-methoxyphenyl)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-dimethyl-λ4-selanyl]ethanone has a molecular weight of 407.37 g/mol, XLogP of 4.48, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxyphenyl)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-dimethyl-λ4-selanyl]ethanone is sourced from PubChem (CID 21357126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).