C12H15NO3 — CID 165177985
3-(4-methoxyphenyl)-N,N-dimethyl-3-oxopropanamide (PubChem CID 165177985) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N,N-dimethyl-3-oxopropanamide.
| Compound Name | 3-(4-methoxyphenyl)-N,N-dimethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 165177985 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 3-(4-methoxyphenyl)-N,N-dimethyl-3-oxopropanamide |
| SMILES | COc1ccc(C(=O)CC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C12H15NO3/c1-13(2)12(15)8-11(14)9-4-6-10(16-3)7-5-9/h4-7H,8H2,1-3H3 |
| InChIKey | KVOYEIZHXATPKG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|