C11H13NO2S — CID 15272504
2-(4-methoxyphenyl)-N,N-dimethyl-2-oxoethanethioamide (PubChem CID 15272504) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N,N-dimethyl-2-oxoethanethioamide.
| Compound Name | 2-(4-methoxyphenyl)-N,N-dimethyl-2-oxoethanethioamide |
|---|---|
| PubChem CID | 15272504 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 2-(4-methoxyphenyl)-N,N-dimethyl-2-oxoethanethioamide |
| SMILES | COc1ccc(C(=O)C(=S)N(C)C)cc1 |
| InChI | InChI=1S/C11H13NO2S/c1-12(2)11(15)10(13)8-4-6-9(14-3)7-5-8/h4-7H,1-3H3 |
| InChIKey | LIGKVXQJQXFKPW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|