C18H20N2O4 — CID 14949074
4-methoxy-N'-(4-methoxybenzoyl)-N,N'-dimethylbenzohydrazide (PubChem CID 14949074) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 4-methoxy-N'-(4-methoxybenzoyl)-N,N'-dimethylbenzohydrazide.
| Compound Name | 4-methoxy-N'-(4-methoxybenzoyl)-N,N'-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 14949074 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 4-methoxy-N'-(4-methoxybenzoyl)-N,N'-dimethylbenzohydrazide |
| SMILES | COc1ccc(C(=O)N(C)N(C)C(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H20N2O4/c1-19(17(21)13-5-9-15(23-3)10-6-13)20(2)18(22)14-7-11-16(24-4)12-8-14/h5-12H,1-4H3 |
| InChIKey | RLSYWECJBSRVJJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|