C9H11ClO2 — CID 23164565
1-(4-methoxyphenyl)ethanone;hydrochloride (PubChem CID 23164565) has the molecular formula C9H11ClO2 and a molecular weight of 186.64 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)ethanone;hydrochloride.
| Compound Name | 1-(4-methoxyphenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 23164565 |
| Molecular Formula | C9H11ClO2 |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 1-(4-methoxyphenyl)ethanone;hydrochloride |
| SMILES | COc1ccc(C(C)=O)cc1.Cl |
| InChI | InChI=1S/C9H10O2.ClH/c1-7(10)8-3-5-9(11-2)6-4-8;/h3-6H,1-2H3;1H |
| InChIKey | KSYXYMNODSUDGV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |