C28H26O4 — CID 91415101
1-[4-(6-methoxynaphthalen-2-yl)phenyl]ethanone;1-(4-methoxyphenyl)ethanone (PubChem CID 91415101) has the molecular formula C28H26O4 and a molecular weight of 426.51 g/mol. Its IUPAC name is 1-[4-(6-methoxynaphthalen-2-yl)phenyl]ethanone;1-(4-methoxyphenyl)ethanone.
| Compound Name | 1-[4-(6-methoxynaphthalen-2-yl)phenyl]ethanone;1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 91415101 |
| Molecular Formula | C28H26O4 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-[4-(6-methoxynaphthalen-2-yl)phenyl]ethanone;1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(C)=O)cc1.COc1ccc2cc(-c3ccc(C(C)=O)cc3)ccc2c1 |
| InChI | InChI=1S/C19H16O2.C9H10O2/c1-13(20)14-3-5-15(6-4-14)16-7-8-18-12-19(21-2)10-9-17(18)11-16;1-7(10)8-3-5-9(11-2)6-4-8/h3-12H,1-2H3;3-6H,1-2H3 |
| InChIKey | OMXRUYPXCCLVBG-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |