C9H7I3O2 — CID 86080929
2,2,2-triiodo-1-(4-methoxyphenyl)ethanone (PubChem CID 86080929) has the molecular formula C9H7I3O2 and a molecular weight of 527.87 g/mol. Its IUPAC name is 2,2,2-triiodo-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2,2,2-triiodo-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 86080929 |
| Molecular Formula | C9H7I3O2 |
| Molecular Weight | 527.87 g/mol |
| Exact Mass | 527.76 |
| IUPAC Name | 2,2,2-triiodo-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)C(I)(I)I)cc1 |
| InChI | InChI=1S/C9H7I3O2/c1-14-7-4-2-6(3-5-7)8(13)9(10,11)12/h2-5H,1H3 |
| InChIKey | QMQANOFYMZHDJL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.87 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|