C12H14O3 — CID 121013341
3-(4-methoxyphenyl)-2,2-dimethyl-3-oxopropanal (PubChem CID 121013341) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2,2-dimethyl-3-oxopropanal.
| Compound Name | 3-(4-methoxyphenyl)-2,2-dimethyl-3-oxopropanal |
|---|---|
| PubChem CID | 121013341 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 3-(4-methoxyphenyl)-2,2-dimethyl-3-oxopropanal |
| SMILES | COc1ccc(C(=O)C(C)(C)C=O)cc1 |
| InChI | InChI=1S/C12H14O3/c1-12(2,8-13)11(14)9-4-6-10(15-3)7-5-9/h4-8H,1-3H3 |
| InChIKey | AGNXWAHNAGXPME-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|