About 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene;terephthalic acid
1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene;terephthalic acid (PubChem CID 22421309) has the molecular formula C25H26O6
and a molecular weight of 422.48 g/mol. Its IUPAC name is 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene;terephthalic acid.
Molecular Properties
| Compound Name | 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene;terephthalic acid |
| PubChem CID | 22421309 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene;terephthalic acid |
| SMILES | COc1ccc(C(C)(C)c2ccc(OC)cc2)cc1.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H20O2.C8H6O4/c1-17(2,13-5-9-15(18-3)10-6-13)14-7-11-16(19-4)12-8-14;9-7(10)5-1-2-6(4-3-5)8(11)12/h5-12H,1-4H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | NHGNOOUQNBQHFY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene;terephthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene;terephthalic acid?
The IUPAC name of 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene;terephthalic acid (CID 22421309) is 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene;terephthalic acid.
What is the SMILES notation for 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene;terephthalic acid?
The canonical SMILES for 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene;terephthalic acid is COc1ccc(C(C)(C)c2ccc(OC)cc2)cc1.O=C(O)c1ccc(C(=O)O)cc1.
What is the InChIKey of 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene;terephthalic acid?
The InChIKey is NHGNOOUQNBQHFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O2.C8H6O4/c1-17(2,13-5-9-15(18-3)10-6-13)14-7-11-16(19-4)12-8-14;9-7(10)5-1-2-6(4-3-5)8(11)12/h5-12H,1-4H3;1-4H,(H,9,10)(H,11,12).
What are the key properties of 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene;terephthalic acid?
1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene;terephthalic acid has a molecular weight of 422.48 g/mol, XLogP of 5.11, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene;terephthalic acid is sourced from PubChem (CID 22421309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).