About ethane;[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] ethaneperoxoate
ethane;[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] ethaneperoxoate (PubChem CID 91574061) has the molecular formula C22H32O4
and a molecular weight of 360.49 g/mol. Its IUPAC name is ethane;[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] ethaneperoxoate.
Molecular Properties
| Compound Name | ethane;[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] ethaneperoxoate |
| PubChem CID | 91574061 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | ethane;[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] ethaneperoxoate |
| SMILES | CC.CC.COc1ccc(C(C)(C)c2ccc(OOC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C18H20O4.2C2H6/c1-13(19)21-22-17-11-7-15(8-12-17)18(2,3)14-5-9-16(20-4)10-6-14;2*1-2/h5-12H,1-4H3;2*1-2H3 |
| InChIKey | YSROXCDJTSWVQT-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethane;[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] ethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] ethaneperoxoate?
The IUPAC name of ethane;[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] ethaneperoxoate (CID 91574061) is ethane;[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] ethaneperoxoate.
What is the SMILES notation for ethane;[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] ethaneperoxoate?
The canonical SMILES for ethane;[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] ethaneperoxoate is CC.CC.COc1ccc(C(C)(C)c2ccc(OOC(C)=O)cc2)cc1.
What is the InChIKey of ethane;[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] ethaneperoxoate?
The InChIKey is YSROXCDJTSWVQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O4.2C2H6/c1-13(19)21-22-17-11-7-15(8-12-17)18(2,3)14-5-9-16(20-4)10-6-14;2*1-2/h5-12H,1-4H3;2*1-2H3.
What are the key properties of ethane;[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] ethaneperoxoate?
ethane;[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] ethaneperoxoate has a molecular weight of 360.49 g/mol, XLogP of 5.93, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] ethaneperoxoate is sourced from PubChem (CID 91574061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).