C12H13F3O3 — CID 150539883
[4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate (PubChem CID 150539883) has the molecular formula C12H13F3O3 and a molecular weight of 262.23 g/mol. Its IUPAC name is [4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate.
| Compound Name | [4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate |
|---|---|
| PubChem CID | 150539883 |
| Molecular Formula | C12H13F3O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | [4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate |
| SMILES | CC(=O)OOc1ccc(C(C)(C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3O3/c1-8(16)17-18-10-6-4-9(5-7-10)11(2,3)12(13,14)15/h4-7H,1-3H3 |
| InChIKey | IFQLPEFADTYCGD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|