About [4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate
[4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate (PubChem CID 150539883) has the molecular formula C12H13F3O3
and a molecular weight of 262.23 g/mol. Its IUPAC name is [4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate.
Molecular Properties
| Compound Name | [4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate |
| PubChem CID | 150539883 |
| Molecular Formula | C12H13F3O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | [4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate |
| SMILES | CC(=O)OOc1ccc(C(C)(C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3O3/c1-8(16)17-18-10-6-4-9(5-7-10)11(2,3)12(13,14)15/h4-7H,1-3H3 |
| InChIKey | IFQLPEFADTYCGD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate?
The IUPAC name of [4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate (CID 150539883) is [4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate.
What is the SMILES notation for [4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate?
The canonical SMILES for [4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate is CC(=O)OOc1ccc(C(C)(C)C(F)(F)F)cc1.
What is the InChIKey of [4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate?
The InChIKey is IFQLPEFADTYCGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3O3/c1-8(16)17-18-10-6-4-9(5-7-10)11(2,3)12(13,14)15/h4-7H,1-3H3.
What are the key properties of [4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate?
[4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate has a molecular weight of 262.23 g/mol, XLogP of 3.38, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl] ethaneperoxoate is sourced from PubChem (CID 150539883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).