About [3-(4-hydroxyphenyl)-2,3-dimethylbutan-2-yl] acetate;trifluoromethylsulfonyl trifluoromethanesulfonate
[3-(4-hydroxyphenyl)-2,3-dimethylbutan-2-yl] acetate;trifluoromethylsulfonyl trifluoromethanesulfonate (PubChem CID 90877791) has the molecular formula C16H20F6O8S2
and a molecular weight of 518.45 g/mol. Its IUPAC name is [3-(4-hydroxyphenyl)-2,3-dimethylbutan-2-yl] acetate;trifluoromethylsulfonyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [3-(4-hydroxyphenyl)-2,3-dimethylbutan-2-yl] acetate;trifluoromethylsulfonyl trifluoromethanesulfonate |
| PubChem CID | 90877791 |
| Molecular Formula | C16H20F6O8S2 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | [3-(4-hydroxyphenyl)-2,3-dimethylbutan-2-yl] acetate;trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | CC(=O)OC(C)(C)C(C)(C)c1ccc(O)cc1.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H20O3.C2F6O5S2/c1-10(15)17-14(4,5)13(2,3)11-6-8-12(16)9-7-11;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h6-9,16H,1-5H3; |
| InChIKey | GRYZMWJYQUZWQP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-hydroxyphenyl)-2,3-dimethylbutan-2-yl] acetate;trifluoromethylsulfonyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-hydroxyphenyl)-2,3-dimethylbutan-2-yl] acetate;trifluoromethylsulfonyl trifluoromethanesulfonate?
The IUPAC name of [3-(4-hydroxyphenyl)-2,3-dimethylbutan-2-yl] acetate;trifluoromethylsulfonyl trifluoromethanesulfonate (CID 90877791) is [3-(4-hydroxyphenyl)-2,3-dimethylbutan-2-yl] acetate;trifluoromethylsulfonyl trifluoromethanesulfonate.
What is the SMILES notation for [3-(4-hydroxyphenyl)-2,3-dimethylbutan-2-yl] acetate;trifluoromethylsulfonyl trifluoromethanesulfonate?
The canonical SMILES for [3-(4-hydroxyphenyl)-2,3-dimethylbutan-2-yl] acetate;trifluoromethylsulfonyl trifluoromethanesulfonate is CC(=O)OC(C)(C)C(C)(C)c1ccc(O)cc1.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of [3-(4-hydroxyphenyl)-2,3-dimethylbutan-2-yl] acetate;trifluoromethylsulfonyl trifluoromethanesulfonate?
The InChIKey is GRYZMWJYQUZWQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3.C2F6O5S2/c1-10(15)17-14(4,5)13(2,3)11-6-8-12(16)9-7-11;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h6-9,16H,1-5H3;.
What are the key properties of [3-(4-hydroxyphenyl)-2,3-dimethylbutan-2-yl] acetate;trifluoromethylsulfonyl trifluoromethanesulfonate?
[3-(4-hydroxyphenyl)-2,3-dimethylbutan-2-yl] acetate;trifluoromethylsulfonyl trifluoromethanesulfonate has a molecular weight of 518.45 g/mol, XLogP of 3.71, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-hydroxyphenyl)-2,3-dimethylbutan-2-yl] acetate;trifluoromethylsulfonyl trifluoromethanesulfonate is sourced from PubChem (CID 90877791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).