C31H43F9O9S3 — CID 160617511
trifluoromethylsulfonyl trifluoromethanesulfonate;4-(2,4,4-trimethylpentan-2-yl)phenol;[4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate (PubChem CID 160617511) has the molecular formula C31H43F9O9S3 and a molecular weight of 826.86 g/mol. Its IUPAC name is trifluoromethylsulfonyl trifluoromethanesulfonate;4-(2,4,4-trimethylpentan-2-yl)phenol;[4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | trifluoromethylsulfonyl trifluoromethanesulfonate;4-(2,4,4-trimethylpentan-2-yl)phenol;[4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 160617511 |
| Molecular Formula | C31H43F9O9S3 |
| Molecular Weight | 826.86 g/mol |
| Exact Mass | 826.19 |
| IUPAC Name | trifluoromethylsulfonyl trifluoromethanesulfonate;4-(2,4,4-trimethylpentan-2-yl)phenol;[4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(O)cc1.CC(C)(C)CC(C)(C)c1ccc(OS(=O)(=O)C(F)(F)F)cc1.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H21F3O3S.C14H22O.C2F6O5S2/c1-13(2,3)10-14(4,5)11-6-8-12(9-7-11)21-22(19,20)15(16,17)18;1-13(2,3)10-14(4,5)11-6-8-12(15)9-7-11;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h6-9H,10H2,1-5H3;6-9,15H,10H2,1-5H3; |
| InChIKey | RGGZGXYBRSXUPK-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.86 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|