C16H22F4O — CID 15514819
1-(1,1,2,2-tetrafluoroethoxy)-4-(2,4,4-trimethylpentan-2-yl)benzene (PubChem CID 15514819) has the molecular formula C16H22F4O and a molecular weight of 306.34 g/mol. Its IUPAC name is 1-(1,1,2,2-tetrafluoroethoxy)-4-(2,4,4-trimethylpentan-2-yl)benzene.
| Compound Name | 1-(1,1,2,2-tetrafluoroethoxy)-4-(2,4,4-trimethylpentan-2-yl)benzene |
|---|---|
| PubChem CID | 15514819 |
| Molecular Formula | C16H22F4O |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-(1,1,2,2-tetrafluoroethoxy)-4-(2,4,4-trimethylpentan-2-yl)benzene |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C16H22F4O/c1-14(2,3)10-15(4,5)11-6-8-12(9-7-11)21-16(19,20)13(17)18/h6-9,13H,10H2,1-5H3 |
| InChIKey | AYAUOMXPHJVCLG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|