C14H21O2P — CID 174932770
1-phosphorosooxy-4-(2,4,4-trimethylpentan-2-yl)benzene (PubChem CID 174932770) has the molecular formula C14H21O2P and a molecular weight of 252.29 g/mol. Its IUPAC name is 1-phosphorosooxy-4-(2,4,4-trimethylpentan-2-yl)benzene.
| Compound Name | 1-phosphorosooxy-4-(2,4,4-trimethylpentan-2-yl)benzene |
|---|---|
| PubChem CID | 174932770 |
| Molecular Formula | C14H21O2P |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-phosphorosooxy-4-(2,4,4-trimethylpentan-2-yl)benzene |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OP=O)cc1 |
| InChI | InChI=1S/C14H21O2P/c1-13(2,3)10-14(4,5)11-6-8-12(9-7-11)16-17-15/h6-9H,10H2,1-5H3 |
| InChIKey | CSBYACUAXOMBLK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|