2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid

C16H23ClO3 — CID 141317147

IUPAC2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid
SMILESCC(C)(C)CC(C)(C)c1ccc(OC(Cl)C(=O)O)cc1
InChIInChI=1S/C16H23ClO3/c1-15(2,3)10-16(4,5)11-6-8-12(9-7-11)20-13(17)14(18)19/h6-9,13H,10H2,1-5H3,(H,18,19)
InChIKeyCDSLLQVJRHLPJZ-UHFFFAOYSA-N
MW298.81 g/mol
LogP4.43
Rot. Bonds5

About 2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid

2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid (PubChem CID 141317147) has the molecular formula C16H23ClO3 and a molecular weight of 298.81 g/mol. Its IUPAC name is 2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid.

Molecular Properties

Compound Name2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid
PubChem CID141317147
Molecular FormulaC16H23ClO3
Molecular Weight298.81 g/mol
Exact Mass298.13
IUPAC Name2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid
SMILESCC(C)(C)CC(C)(C)c1ccc(OC(Cl)C(=O)O)cc1
InChIInChI=1S/C16H23ClO3/c1-15(2,3)10-16(4,5)11-6-8-12(9-7-11)20-13(17)14(18)19/h6-9,13H,10H2,1-5H3,(H,18,19)
InChIKeyCDSLLQVJRHLPJZ-UHFFFAOYSA-N
XLogP4.43
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.81
LogP ≤ 54.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid?
The IUPAC name of 2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid (CID 141317147) is 2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid.
What is the SMILES notation for 2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid?
The canonical SMILES for 2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid is CC(C)(C)CC(C)(C)c1ccc(OC(Cl)C(=O)O)cc1.
What is the InChIKey of 2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid?
The InChIKey is CDSLLQVJRHLPJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23ClO3/c1-15(2,3)10-16(4,5)11-6-8-12(9-7-11)20-13(17)14(18)19/h6-9,13H,10H2,1-5H3,(H,18,19).
What are the key properties of 2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid?
2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid has a molecular weight of 298.81 g/mol, XLogP of 4.43, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid is sourced from PubChem (CID 141317147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).