C16H23ClO3 — CID 141317147
2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid (PubChem CID 141317147) has the molecular formula C16H23ClO3 and a molecular weight of 298.81 g/mol. Its IUPAC name is 2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid.
| Compound Name | 2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 141317147 |
| Molecular Formula | C16H23ClO3 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-chloro-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OC(Cl)C(=O)O)cc1 |
| InChI | InChI=1S/C16H23ClO3/c1-15(2,3)10-16(4,5)11-6-8-12(9-7-11)20-13(17)14(18)19/h6-9,13H,10H2,1-5H3,(H,18,19) |
| InChIKey | CDSLLQVJRHLPJZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|