C27H37ClO3 — CID 67908291
7-(4-chlorophenyl)-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]heptanoic acid (PubChem CID 67908291) has the molecular formula C27H37ClO3 and a molecular weight of 445.04 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]heptanoic acid.
| Compound Name | 7-(4-chlorophenyl)-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]heptanoic acid |
|---|---|
| PubChem CID | 67908291 |
| Molecular Formula | C27H37ClO3 |
| Molecular Weight | 445.04 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 7-(4-chlorophenyl)-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]heptanoic acid |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OC(CCCCCc2ccc(Cl)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C27H37ClO3/c1-26(2,3)19-27(4,5)21-13-17-23(18-14-21)31-24(25(29)30)10-8-6-7-9-20-11-15-22(28)16-12-20/h11-18,24H,6-10,19H2,1-5H3,(H,29,30) |
| InChIKey | AUYXMYLAVXFPSS-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.04 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|