C19H20Cl2O3 — CID 133245667
2-(4-tert-butylphenoxy)-3-(3,5-dichlorophenyl)propanoic acid (PubChem CID 133245667) has the molecular formula C19H20Cl2O3 and a molecular weight of 367.27 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-3-(3,5-dichlorophenyl)propanoic acid.
| Compound Name | 2-(4-tert-butylphenoxy)-3-(3,5-dichlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 133245667 |
| Molecular Formula | C19H20Cl2O3 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-3-(3,5-dichlorophenyl)propanoic acid |
| SMILES | CC(C)(C)c1ccc(OC(Cc2cc(Cl)cc(Cl)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H20Cl2O3/c1-19(2,3)13-4-6-16(7-5-13)24-17(18(22)23)10-12-8-14(20)11-15(21)9-12/h4-9,11,17H,10H2,1-3H3,(H,22,23) |
| InChIKey | GQBUNLPXAQHZES-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |