C19H21ClO3 — CID 100533221
(2S)-2-(4-tert-butylphenoxy)-3-(2-chlorophenyl)propanoic acid (PubChem CID 100533221) has the molecular formula C19H21ClO3 and a molecular weight of 332.83 g/mol. Its IUPAC name is (2S)-2-(4-tert-butylphenoxy)-3-(2-chlorophenyl)propanoic acid.
| Compound Name | (2S)-2-(4-tert-butylphenoxy)-3-(2-chlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 100533221 |
| Molecular Formula | C19H21ClO3 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (2S)-2-(4-tert-butylphenoxy)-3-(2-chlorophenyl)propanoic acid |
| SMILES | CC(C)(C)c1ccc(O[C@@H](Cc2ccccc2Cl)C(=O)O)cc1 |
| InChI | InChI=1S/C19H21ClO3/c1-19(2,3)14-8-10-15(11-9-14)23-17(18(21)22)12-13-6-4-5-7-16(13)20/h4-11,17H,12H2,1-3H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | NUCOUCULFTUZJR-KRWDZBQOSA-N |
| XLogP | 4.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |