C15H12Cl2O3 — CID 133245608
3-(2,4-dichlorophenyl)-2-phenoxypropanoic acid (PubChem CID 133245608) has the molecular formula C15H12Cl2O3 and a molecular weight of 311.16 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-2-phenoxypropanoic acid.
| Compound Name | 3-(2,4-dichlorophenyl)-2-phenoxypropanoic acid |
|---|---|
| PubChem CID | 133245608 |
| Molecular Formula | C15H12Cl2O3 |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-2-phenoxypropanoic acid |
| SMILES | O=C(O)C(Cc1ccc(Cl)cc1Cl)Oc1ccccc1 |
| InChI | InChI=1S/C15H12Cl2O3/c16-11-7-6-10(13(17)9-11)8-14(15(18)19)20-12-4-2-1-3-5-12/h1-7,9,14H,8H2,(H,18,19) |
| InChIKey | LYRVMLRUIPBOSE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |