C27H21ClO4 — CID 100550207
(2R)-3-(5-chloro-2-phenoxyphenyl)-2-(4-phenylphenoxy)propanoic acid (PubChem CID 100550207) has the molecular formula C27H21ClO4 and a molecular weight of 444.91 g/mol. Its IUPAC name is (2R)-3-(5-chloro-2-phenoxyphenyl)-2-(4-phenylphenoxy)propanoic acid.
| Compound Name | (2R)-3-(5-chloro-2-phenoxyphenyl)-2-(4-phenylphenoxy)propanoic acid |
|---|---|
| PubChem CID | 100550207 |
| Molecular Formula | C27H21ClO4 |
| Molecular Weight | 444.91 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | (2R)-3-(5-chloro-2-phenoxyphenyl)-2-(4-phenylphenoxy)propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1cc(Cl)ccc1Oc1ccccc1)Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H21ClO4/c28-22-13-16-25(31-23-9-5-2-6-10-23)21(17-22)18-26(27(29)30)32-24-14-11-20(12-15-24)19-7-3-1-4-8-19/h1-17,26H,18H2,(H,29,30)/t26-/m1/s1 |
| InChIKey | NNZHUEQHTGNZQT-AREMUKBSSA-N |
| XLogP | 6.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.91 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |