C23H21ClO4 — CID 100550322
(2S)-3-(5-chloro-2-phenoxyphenyl)-2-(3,4-dimethylphenoxy)propanoic acid (PubChem CID 100550322) has the molecular formula C23H21ClO4 and a molecular weight of 396.87 g/mol. Its IUPAC name is (2S)-3-(5-chloro-2-phenoxyphenyl)-2-(3,4-dimethylphenoxy)propanoic acid.
| Compound Name | (2S)-3-(5-chloro-2-phenoxyphenyl)-2-(3,4-dimethylphenoxy)propanoic acid |
|---|---|
| PubChem CID | 100550322 |
| Molecular Formula | C23H21ClO4 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (2S)-3-(5-chloro-2-phenoxyphenyl)-2-(3,4-dimethylphenoxy)propanoic acid |
| SMILES | Cc1ccc(O[C@@H](Cc2cc(Cl)ccc2Oc2ccccc2)C(=O)O)cc1C |
| InChI | InChI=1S/C23H21ClO4/c1-15-8-10-20(12-16(15)2)28-22(23(25)26)14-17-13-18(24)9-11-21(17)27-19-6-4-3-5-7-19/h3-13,22H,14H2,1-2H3,(H,25,26)/t22-/m0/s1 |
| InChIKey | GNGUKSOXSHOXSL-QFIPXVFZSA-N |
| XLogP | 5.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |