C23H22O4 — CID 100544971
(2S)-2-(3,4-dimethylphenoxy)-3-(4-phenoxyphenyl)propanoic acid (PubChem CID 100544971) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethylphenoxy)-3-(4-phenoxyphenyl)propanoic acid.
| Compound Name | (2S)-2-(3,4-dimethylphenoxy)-3-(4-phenoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 100544971 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (2S)-2-(3,4-dimethylphenoxy)-3-(4-phenoxyphenyl)propanoic acid |
| SMILES | Cc1ccc(O[C@@H](Cc2ccc(Oc3ccccc3)cc2)C(=O)O)cc1C |
| InChI | InChI=1S/C23H22O4/c1-16-8-11-21(14-17(16)2)27-22(23(24)25)15-18-9-12-20(13-10-18)26-19-6-4-3-5-7-19/h3-14,22H,15H2,1-2H3,(H,24,25)/t22-/m0/s1 |
| InChIKey | SOUQZHXUNPCVTD-QFIPXVFZSA-N |
| XLogP | 5.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |